69999-15-1 Usage
General Description
2,3-Dihydro-alpha-hydroxy-5-benzofuranacetic acid is a complex organic compound that plays a significant role in the field of organic chemistry. It is typically characterized by its benzofuran structure, which is a heterocyclic compound, and its carboxylic acid group, which gives it its acidic properties. This chemical is generally used in research settings for various applications due to its unique structure and reactivity. However, as it is a specialized compound, its detailed properties including its toxicity, environmental impact, or commercial applications aren't largely documented or explored. The manipulation of the compound generally requires professional expertise and stringent safety measures.
Check Digit Verification of cas no
The CAS Registry Mumber 69999-15-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,9,9 and 9 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 69999-15:
(7*6)+(6*9)+(5*9)+(4*9)+(3*9)+(2*1)+(1*5)=211
211 % 10 = 1
So 69999-15-1 is a valid CAS Registry Number.
InChI:InChI=1S/C10H10O4/c11-9(10(12)13)7-1-2-8-6(5-7)3-4-14-8/h1-2,5,9,11H,3-4H2,(H,12,13)
69999-15-1Relevant articles and documents
7-(2,3-Dihydrobenzo-5-furanyl)-acetamido cephalosporin derivatives
-
, (2008/06/13)
This invention is directed to new 7-(2,3-dihydrobenzo-5-furanyl)acetamido cephalosporin derivatives and methods for preparing them.
6-(2,3-Dihydro-5-benzofuranyl)acetamido penicillin derivatives
-
, (2008/06/13)
New 6-(2,3-dihydro-5-benzofuranyl)acetamido penicillin compounds are described which are useful as antibacterial agents.
