70325-83-6 Usage
Uses
Since the provided materials do not specify the uses of nemonapride, we can only infer potential applications based on its chemical structure and properties as a benzamide derivative. Here are some possible applications:
Used in Pharmaceutical Industry:
Nemonapride is used as a pharmaceutical compound for its potential therapeutic effects. As a benzamide derivative, it may have applications in the treatment of various medical conditions, such as neurological disorders or other diseases where its specific properties can be utilized.
Used in Chemical Research:
In the field of chemical research, nemonapride can be used as a research tool to study the structure-activity relationships of benzamide derivatives and their potential applications in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 70325-83-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,3,2 and 5 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 70325-83:
(7*7)+(6*0)+(5*3)+(4*2)+(3*5)+(2*8)+(1*3)=106
106 % 10 = 6
So 70325-83-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H26ClN3O2/c1-14-18(9-10-25(14)13-15-7-5-4-6-8-15)24-21(26)16-11-17(22)19(23-2)12-20(16)27-3/h4-8,11-12,14,18,23H,9-10,13H2,1-3H3,(H,24,26)