705-79-3 Usage
Uses
Used in Pharmaceutical Industry:
3-Chloro-4-fluorophenylacetic acid is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with specific therapeutic properties, contributing to the advancement of medical treatments.
Used in Chemical Synthesis:
In the chemical industry, 3-Chloro-4-fluorophenylacetic acid is utilized as an intermediate for the production of a wide range of chemical products. Its versatility in organic synthesis makes it a valuable component in the creation of various compounds with different applications, such as agrochemicals, dyes, and other specialty chemicals.
Used in Research and Development:
3-Chloro-4-fluorophenylacetic acid is also employed in research and development settings, where it is used to study the effects of its unique structure on the properties and reactivity of synthesized compounds. This helps scientists and researchers to better understand the underlying principles of organic chemistry and to develop new methodologies and techniques for chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 705-79-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,0 and 5 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 705-79:
(5*7)+(4*0)+(3*5)+(2*7)+(1*9)=73
73 % 10 = 3
So 705-79-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClFO2/c9-6-3-5(4-8(11)12)1-2-7(6)10/h1-3H,4H2,(H,11,12)
705-79-3Relevant academic research and scientific papers
ARYLACETAMIDE ANALOGS OF PIPERAZINE-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZINES
-
Paragraph 0108; 0110-0111, (2021/12/31)
Provided are compounds with the following structure: Formula (I), and methods of making and using same. The methods of using the compounds may be methods for treating or prophylaxis of a cryptosporidium infection.
