7057-22-9 Usage
Uses
Used in Pharmaceutical Industry:
1H-Pyrazolo[4,3-d]pyrimidin-7-amine, 3-methyl(9CI) is used as an intermediate in the synthesis of pharmaceuticals for its potential to contribute to the development of new drugs. Its structure allows for further chemical modifications, enabling the creation of a variety of drug candidates with different therapeutic properties.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 1H-Pyrazolo[4,3-d]pyrimidin-7-amine, 3-methyl(9CI) is used as a building block for designing and synthesizing novel compounds with potential therapeutic applications. Its amine and methyl groups provide opportunities for structural modifications, which can lead to the discovery of new drugs with improved efficacy and selectivity.
Used in Drug Development:
1H-Pyrazolo[4,3-d]pyrimidin-7-amine, 3-methyl(9CI) plays a crucial role in drug development as a precursor for creating new organic compounds with potential medicinal properties. Its versatility in chemical reactions allows researchers to explore various synthetic pathways, leading to the development of innovative drugs for treating various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 7057-22-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,0,5 and 7 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7057-22:
(6*7)+(5*0)+(4*5)+(3*7)+(2*2)+(1*2)=89
89 % 10 = 9
So 7057-22-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N5/c1-3-4-5(11-10-3)6(7)9-2-8-4/h2H,1H3,(H,10,11)(H2,7,8,9)
