706789-07-3 Usage
Uses
Used in Pharmaceutical Industry:
2-Chlorooxazole-4-carboxylic acid is used as a key intermediate for the synthesis of 4-Bromomethyl-2-chlorooxazole, which is a valuable building block in the development of novel pharmaceuticals. Its unique structure and reactivity make it suitable for the creation of diverse drug candidates with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Chlorooxazole-4-carboxylic acid serves as a crucial component in the synthesis of new pesticides and other crop protection agents. Its ability to form stable and bioactive molecules contributes to the development of effective solutions for agricultural challenges.
Used in Specialty Chemicals:
2-Chlorooxazole-4-carboxylic acid is also utilized in the synthesis of specialty chemicals, such as dyes, fragrances, and other functional materials. Its versatility in cross-coupling reactions allows for the creation of a wide range of chemical entities with specific properties tailored for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 706789-07-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,0,6,7,8 and 9 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 706789-07:
(8*7)+(7*0)+(6*6)+(5*7)+(4*8)+(3*9)+(2*0)+(1*7)=193
193 % 10 = 3
So 706789-07-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H2ClNO3/c5-4-6-2(1-9-4)3(7)8/h1H,(H,7,8)