7083-63-8 Usage
Uses
Used in Pharmaceutical Synthesis:
9H-Fluoren-4-amine is used as a key intermediate in the synthesis of pharmaceuticals for its ability to facilitate the creation of complex molecular structures that can exhibit therapeutic effects.
Used in Organic Compounds Synthesis:
As a building block, 9H-Fluoren-4-amine is utilized in the synthesis of various organic compounds, contributing to the development of new chemical entities with potential applications across different industries.
Used in Organic Light-Emitting Diodes (OLEDs):
9H-Fluoren-4-amine is used as a component in the development of OLEDs due to its electronic and optoelectronic properties, which are essential for the efficient functioning of these devices.
Used in Materials Science:
9H-Fluoren-4-amine is employed as a building block in the development of new materials with electronic and optoelectronic properties, indicating its potential in advancing the field of materials science for various high-tech applications.
Used in Chemical Industry:
9H-Fluoren-4-amine's chemical properties make it a versatile component in the chemical industry, where it can be used to create a wide range of products, from specialty chemicals to advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 7083-63-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,0,8 and 3 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 7083-63:
(6*7)+(5*0)+(4*8)+(3*3)+(2*6)+(1*3)=98
98 % 10 = 8
So 7083-63-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H11N/c14-12-7-3-5-10-8-9-4-1-2-6-11(9)13(10)12/h1-7H,8,14H2
