71172-25-3 Usage
Structure
Six-membered ring containing oxygen and sulfur atoms, with two methyl groups attached
Steric hindrance
The presence of the two methyl groups adds steric hindrance, affecting the reactivity and physical properties of the compound
Use in chemical synthesis
Commonly used as a building block for the production of various organic compounds
Aroma
Known for its unique aroma, used as a component in the formulation of perfumes and fragrances
Pharmaceutical potential
Studied for its potential use in pharmaceuticals and as a precursor to biologically active compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 71172-25-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,1,7 and 2 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 71172-25:
(7*7)+(6*1)+(5*1)+(4*7)+(3*2)+(2*2)+(1*5)=103
103 % 10 = 3
So 71172-25-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H12OS/c1-5-3-8-4-6(2)7-5/h5-6H,3-4H2,1-2H3