7142-09-8 Usage
Uses
Used in Pharmaceutical Synthesis:
6-Chloro-2-methyl-4(1H)-quinazolinone is used as a building block in the synthesis of pharmaceuticals and organic compounds. Its unique structure and functional groups make it a valuable component in the development of new drugs with potential therapeutic applications.
Used in Antimicrobial Applications:
6-Chloro-2-methyl-4(1H)-quinazolinone has been investigated for its antimicrobial properties. It demonstrates the ability to inhibit the growth of various bacteria, making it a potential candidate for use in the development of new antimicrobial agents to combat bacterial infections.
Used in Antifungal Applications:
6-chloro-2-methyl-4(1H)-quinazolinone has also shown potential as an antifungal agent, exhibiting the ability to inhibit the growth of fungi. Its antifungal properties make it a promising candidate for use in the development of new antifungal drugs to treat fungal infections.
Used in Antiviral Applications:
6-Chloro-2-methyl-4(1H)-quinazolinone has been studied for its potential antiviral properties. It has shown the ability to inhibit the replication of certain viruses, making it a potential candidate for use in the development of new antiviral drugs to treat viral infections.
Used in Materials Science:
In addition to its biological activities, 6-chloro-2-methyl-4(1H)-quinazolinone has been utilized in the development of new materials. Its unique chemical structure and properties make it a valuable component in the creation of advanced materials with potential applications in various industries.
Used in Organic Synthesis Processes:
6-Chloro-2-methyl-4(1H)-quinazolinone has been employed in organic synthesis processes, where it serves as a key intermediate or reactant in the synthesis of various organic compounds. Its versatility and reactivity make it a valuable tool in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 7142-09-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,1,4 and 2 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 7142-09:
(6*7)+(5*1)+(4*4)+(3*2)+(2*0)+(1*9)=78
78 % 10 = 8
So 7142-09-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H7ClN2O/c1-5-11-8-3-2-6(10)4-7(8)9(13)12-5/h2-4H,1H3,(H,11,12,13)
