71501-08-1 Usage
Uses
Used in Organometallic Chemistry:
DI-N-PENTYLPHENYLPHOSPHINE is used as a ligand for stabilizing various metal complexes, enhancing their properties and reactivity in chemical reactions.
Used in Catalytic Reactions:
It serves as a component in transition metal-catalyzed transformations, where it contributes to the efficiency and selectivity of the catalytic processes.
Used in Organic Synthesis:
DI-N-PENTYLPHENYLPHOSPHINE is utilized in organic synthesis, where it aids in the formation of desired organic compounds through its reactivity and stabilizing properties.
Used as a Reagent in Chemical Reactions:
DI-N-PENTYLPHENYLPHOSPHINE functions as a reagent, facilitating specific chemical reactions and contributing to the synthesis of target molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 71501-08-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,5,0 and 1 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 71501-08:
(7*7)+(6*1)+(5*5)+(4*0)+(3*1)+(2*0)+(1*8)=91
91 % 10 = 1
So 71501-08-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H27P/c1-3-5-10-14-17(15-11-6-4-2)16-12-8-7-9-13-16/h7-9,12-13H,3-6,10-11,14-15H2,1-2H3
