716-32-5 Usage
Uses
Used in Pharmaceutical Industry:
6-Nitro-1,3-benzodioxole-5-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure and functional groups allow for the development of new drugs with improved therapeutic properties and efficacy.
Used in Agrochemical Industry:
In the agrochemical industry, 6-nitro-1,3-benzodioxole-5-carboxylic acid serves as a building block for the synthesis of various agrochemicals, including pesticides and herbicides. Its versatile reactivity enables the creation of novel compounds with enhanced performance and selectivity.
Used in Material Science:
6-Nitro-1,3-benzodioxole-5-carboxylic acid has potential applications in the development of new materials, such as polymers and composites, due to its unique chemical properties. Its incorporation into these materials can lead to improved properties, such as enhanced stability, durability, and functionality.
Used in Dye Industry:
6-NITRO-1,3-BENZODIOXOLE-5-CARBOXYLIC ACID also has potential applications in the dye industry, where it can be used to develop new dyes with unique color properties and improved performance characteristics. Its versatile reactivity allows for the synthesis of a wide range of dyes with different color shades and stability profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 716-32-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,1 and 6 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 716-32:
(5*7)+(4*1)+(3*6)+(2*3)+(1*2)=65
65 % 10 = 5
So 716-32-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H5NO6/c10-8(11)4-1-6-7(15-3-14-6)2-5(4)9(12)13/h1-2H,3H2,(H,10,11)
