71672-88-3 Usage
Description
4-Bromo-3-methylphenyl isothiocyanate, also known as 3-bromo-4-methylphenyl isothiocyanate, is an organic compound that is commonly used in the synthesis of complex organic molecules. It is a derivative of phenyl isothiocyanate, with the bromine and methyl groups attached to the phenyl ring. This chemical is often utilized in the pharmaceutical industry for the development of new drugs and in organic chemistry research for the creation of various organic compounds. It is also used as a reagent in chemical reactions to form carbon-sulfur bonds and has potential applications in the development of new materials and biological studies.
Uses
Used in Pharmaceutical Industry:
4-Bromo-3-methylphenyl isothiocyanate is used as a building block for the development of new drugs, particularly in the synthesis of complex organic molecules.
Used in Organic Chemistry Research:
4-Bromo-3-methylphenyl isothiocyanate is used as a reagent in chemical reactions to form carbon-sulfur bonds, enabling the creation of various organic compounds.
Used in Material Development:
4-Bromo-3-methylphenyl isothiocyanate has potential applications in the development of new materials, contributing to advancements in various industries.
Used in Biological Studies:
4-Bromo-3-methylphenyl isothiocyanate is utilized in biological studies, providing insights into its potential applications and interactions with biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 71672-88-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,6,7 and 2 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 71672-88:
(7*7)+(6*1)+(5*6)+(4*7)+(3*2)+(2*8)+(1*8)=143
143 % 10 = 3
So 71672-88-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H6BrNS/c1-6-4-7(10-5-11)2-3-8(6)9/h2-4H,1H3