7285-32-7 Usage
Uses
Used in Research Applications:
Thiete-1,1-dioxide is used as a research chemical for studying chemical reactions involving sulfur oxides. Its unique structure and properties make it a valuable compound for exploring various chemical pathways and mechanisms in the field of organic chemistry.
Used in Pharmaceutical Industry:
Although not explicitly mentioned in the provided materials, Thiete-1,1-dioxide could potentially be used as a building block or intermediate in the synthesis of pharmaceutical compounds, given its heteroaromatic nature and the presence of a sulfur atom. This could lead to the development of new drugs with novel therapeutic properties.
Used in Material Science:
Thiete-1,1-dioxide may also find applications in material science, particularly in the development of new materials with unique electronic, optical, or mechanical properties. The incorporation of sulfur atoms into the molecular structure of Thiete-1,1-dioxide could potentially influence the material's characteristics, making it a candidate for further investigation in this field.
Check Digit Verification of cas no
The CAS Registry Mumber 7285-32-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,2,8 and 5 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7285-32:
(6*7)+(5*2)+(4*8)+(3*5)+(2*3)+(1*2)=107
107 % 10 = 7
So 7285-32-7 is a valid CAS Registry Number.
InChI:InChI=1/C3H4O2S/c4-6(5)2-1-3-6/h1-2H,3H2
