7314-65-0 Usage
Uses
Used in Pharmaceutical and Medicinal Applications:
Pyrimidine, 4-methoxy-2-methyl(6CI,7CI,8CI,9CI) is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and potential biological activities make it a valuable component in the development of new drugs and therapeutic agents.
Used in Medicinal Chemistry Research:
Pyrimidine, 4-methoxy-2-methyl(6CI,7CI,8CI,9CI) is utilized as a research compound in the field of medicinal chemistry. Its unique structure and potential interactions with biological targets make it an interesting candidate for studying the design and development of new drugs and therapeutic agents.
Used in Drug Development:
Pyrimidine, 4-methoxy-2-methyl(6CI,7CI,8CI,9CI) is employed in drug development as a potential lead compound for the discovery of new pharmaceutical agents. Its unique structure and potential biological activities provide a foundation for further optimization and modification to enhance its therapeutic properties and efficacy.
Check Digit Verification of cas no
The CAS Registry Mumber 7314-65-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,3,1 and 4 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 7314-65:
(6*7)+(5*3)+(4*1)+(3*4)+(2*6)+(1*5)=90
90 % 10 = 0
So 7314-65-0 is a valid CAS Registry Number.
InChI:InChI=1S/C6H8N2O/c1-5-7-4-3-6(8-5)9-2/h3-4H,1-2H3
