73214-24-1 Usage
Uses
Used in Pharmaceutical Industry:
3-Chloro-6-phenyl-1,2,4-triazine is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Chloro-6-phenyl-1,2,4-triazine serves as a precursor in the production of pesticides and other agrochemicals. Its incorporation into these products can enhance their effectiveness in protecting crops and managing pests.
Used in Dye Industry:
3-Chloro-6-phenyl-1,2,4-triazine is utilized as a building block in the creation of dyes. Its chemical properties make it suitable for the development of dyes with specific color characteristics and stability, important for various applications such as textiles and printing.
Used in Disease Treatment Research:
3-Chloro-6-phenyl-1,2,4-triazine has been studied for its potential therapeutic applications in treating certain diseases. Its unique molecular structure may offer new avenues for drug discovery and development, providing hope for novel treatments.
Used in Environmental Monitoring:
As a potential environmental contaminant, 3-Chloro-6-phenyl-1,2,4-triazine is subject to environmental monitoring and regulation. Its detection and analysis in various ecosystems help in understanding its impact on the environment and ensuring compliance with environmental safety standards.
Check Digit Verification of cas no
The CAS Registry Mumber 73214-24-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,2,1 and 4 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 73214-24:
(7*7)+(6*3)+(5*2)+(4*1)+(3*4)+(2*2)+(1*4)=101
101 % 10 = 1
So 73214-24-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H6ClN3/c10-9-11-6-8(12-13-9)7-4-2-1-3-5-7/h1-6H
