7325-21-5 Usage
General Description
H-GLY-LEU-GLY-GLY-OH is a chemical compound consisting of the amino acids glycine (Gly) and leucine (Leu), with the addition of a hydroxyl group (OH). Glycine is the simplest amino acid and is known for its involvement in building proteins, whereas leucine is an essential amino acid that plays a key role in protein synthesis and muscle growth. H-GLY-LEU-GLY-GLY-OH is often used in research and pharmaceutical development to study the effects of specific amino acid sequences on biological processes and to potentially develop new drugs or therapies. The chemical structure of H-GLY-LEU-GLY-GLY-OH allows for the investigation of its interactions with other molecules and its potential biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 7325-21-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,3,2 and 5 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 7325-21:
(6*7)+(5*3)+(4*2)+(3*5)+(2*2)+(1*1)=85
85 % 10 = 5
So 7325-21-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H22N4O5/c1-7(2)3-8(16-9(17)4-13)12(21)15-5-10(18)14-6-11(19)20/h7-8H,3-6,13H2,1-2H3,(H,14,18)(H,15,21)(H,16,17)(H,19,20)
