7325-21-5 Usage
Uses
Used in Pharmaceutical Development:
H-GLY-LEU-GLY-GLY-OH is used as a research compound for studying the effects of specific amino acid sequences on biological processes. Its chemical structure allows for the investigation of its interactions with other molecules and its potential biological activities, which can contribute to the development of new drugs or therapies.
Used in Research:
H-GLY-LEU-GLY-GLY-OH is used as a research tool to explore the interactions between amino acids and their influence on biological systems. This can help scientists better understand the mechanisms of protein synthesis and muscle growth, as well as identify potential therapeutic targets for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 7325-21-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,3,2 and 5 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 7325-21:
(6*7)+(5*3)+(4*2)+(3*5)+(2*2)+(1*1)=85
85 % 10 = 5
So 7325-21-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H22N4O5/c1-7(2)3-8(16-9(17)4-13)12(21)15-5-10(18)14-6-11(19)20/h7-8H,3-6,13H2,1-2H3,(H,14,18)(H,15,21)(H,16,17)(H,19,20)
