74022-33-6 Usage
Uses
Used in Pharmaceutical Industry:
2-AMINO-6-ISOPROPYL-4,5,6,7-TETRAHYDRO-THIENO-[2,3-C]PYRIDINE-3-CARBOXYLIC ACID ETHYL ESTER is used as a potential active pharmaceutical ingredient for its possible biological activities related to the central nervous system or cardiovascular system. Its unique structure may contribute to the development of new drugs targeting various diseases.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 2-AMINO-6-ISOPROPYL-4,5,6,7-TETRAHYDRO-THIENO-[2,3-C]PYRIDINE-3-CARBOXYLIC ACID ETHYL ESTER serves as a subject of ongoing research and exploration. Its complex structure and potential therapeutic effects make it a valuable compound for studying the design and synthesis of new drugs with improved efficacy and safety profiles.
Used in Drug Development:
2-AMINO-6-ISOPROPYL-4,5,6,7-TETRAHYDRO-THIENO-[2,3-C]PYRIDINE-3-CARBOXYLIC ACID ETHYL ESTER is utilized in drug development as a lead compound for the discovery of novel therapeutic agents. Its potential applications in treating various diseases, along with its unique structural features, make it a promising candidate for further optimization and development into effective medications.
Check Digit Verification of cas no
The CAS Registry Mumber 74022-33-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,0,2 and 2 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 74022-33:
(7*7)+(6*4)+(5*0)+(4*2)+(3*2)+(2*3)+(1*3)=96
96 % 10 = 6
So 74022-33-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H20N2O2S/c1-4-17-13(16)11-9-5-6-15(8(2)3)7-10(9)18-12(11)14/h8H,4-7,14H2,1-3H3/p+1
74022-33-6Relevant academic research and scientific papers
The first example of tetrahydrothieno[3,2-d]azocines synthesis
Voskressensky, Leonid G.,Listratova, Anna V.,Borisova, Tatiana N.,Kovaleva, Svetlana A.,Borisov, Roman S.,Varlamov, Alexey V.
scheme or table, p. 10443 - 10452 (2009/04/11)
A novel and efficient one-pot synthesis of thieno[3,2-d]azocines based on tamden transformation of tetrahydropyridine ring was elaborated.
