74585-98-1 Usage
Uses
Used in Pharmaceutical Industry:
QUINOLINE-4-CARBOTHIOIC ACID AMIDE is used as a building block for the synthesis of pharmaceuticals due to its potential antifungal, antimicrobial, and anticancer properties. Its versatile chemical structure allows for the development of new drugs with improved efficacy and reduced side effects.
Used in Agrochemical Industry:
In the agrochemical industry, QUINOLINE-4-CARBOTHIOIC ACID AMIDE is used as a building block for the synthesis of agrochemicals. Its antifungal and antimicrobial properties make it a valuable component in the development of pesticides and fungicides, helping to protect crops from various diseases and pests.
Used in Materials Science:
QUINOLINE-4-CARBOTHIOIC ACID AMIDE is used in the development of dyes, pigments, and fluorescent materials. Its unique chemical properties contribute to the creation of novel materials with enhanced performance characteristics, such as improved color intensity, stability, and fluorescence efficiency.
Overall, QUINOLINE-4-CARBOTHIOIC ACID AMIDE has a wide range of industrial and research applications due to its versatile properties, making it an essential compound in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 74585-98-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,5,8 and 5 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 74585-98:
(7*7)+(6*4)+(5*5)+(4*8)+(3*5)+(2*9)+(1*8)=171
171 % 10 = 1
So 74585-98-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2S/c11-10(13)8-5-6-12-9-4-2-1-3-7(8)9/h1-6H,(H2,11,13)
