748812-37-5 Usage
Uses
Used in Pharmaceutical Industry:
2-Amino-5-bromo-3-fluoropyridine is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure and reactivity enable the development of new drugs with specific therapeutic properties. It plays a crucial role in the creation of novel compounds with potential applications in treating various diseases and medical conditions.
Used in Agricultural Chemical Industry:
In the agricultural chemical industry, 2-Amino-5-bromo-3-fluoropyridine is utilized as an intermediate for the synthesis of agrochemicals, such as pesticides and herbicides. Its ability to form a wide range of products through chemical reactions contributes to the development of effective and targeted solutions for crop protection and management.
Used in Organic Synthesis:
2-Amino-5-bromo-3-fluoropyridine is employed as a versatile building block in organic synthesis. Its reactivity allows chemists to create a diverse array of organic compounds for various applications, including the development of new materials, dyes, and other specialty chemicals.
Safety Precautions:
Due to its potential to cause irritation to the skin, eyes, and respiratory system, it is essential to handle and store 2-amino-5-bromo-3-fluoropyridine with care. Proper safety protocols, including the use of personal protective equipment (PPE) and adherence to hazard communication guidelines, should be followed to prevent accidental exposure and harm.
Check Digit Verification of cas no
The CAS Registry Mumber 748812-37-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,4,8,8,1 and 2 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 748812-37:
(8*7)+(7*4)+(6*8)+(5*8)+(4*1)+(3*2)+(2*3)+(1*7)=195
195 % 10 = 5
So 748812-37-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H4BrFN2/c6-3-1-4(7)5(8)9-2-3/h1-2H,(H2,8,9)
