7506-49-2 Usage
Uses
Used in Organic Synthesis:
(3-methylphenyl) 4-nitrobenzoate is used as an intermediate in the synthesis of various organic compounds. Its versatile structure allows for the creation of a wide range of derivatives, making it a valuable building block in the development of new chemical entities.
Used in Pharmaceutical Production:
As an intermediate, (3-methylphenyl) 4-nitrobenzoate plays a crucial role in the production of pharmaceuticals. Its unique structure can be utilized to develop new drugs with potential therapeutic benefits.
Used in Dye Manufacturing:
(3-methylphenyl) 4-nitrobenzoate is also used in the manufacturing of dyes. Its chemical properties contribute to the formation of dyes with specific color characteristics, making it an important component in the dye industry.
Used in Drug Discovery:
Due to its unique chemical structure, (3-methylphenyl) 4-nitrobenzoate may have potential uses in drug discovery. Researchers can explore its properties to identify new therapeutic agents or improve existing ones.
Used in Chemical Research:
(3-methylphenyl) 4-nitrobenzoate serves as a valuable compound in chemical research. Its properties can be studied to gain insights into the behavior of similar chemical entities, contributing to the broader understanding of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 7506-49-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,0 and 6 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 7506-49:
(6*7)+(5*5)+(4*0)+(3*6)+(2*4)+(1*9)=102
102 % 10 = 2
So 7506-49-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H11NO4/c1-10-3-2-4-13(9-10)19-14(16)11-5-7-12(8-6-11)15(17)18/h2-9H,1H3
7506-49-2Relevant academic research and scientific papers
Pd(II)-catalyzed C-H activation/aryl-aryl coupling of phenol esters
Xiao, Bin,Fu, Yao,Xu, Jun,Gong, Tian-Jun,Dai, Jian-Jun,Yi, Jun,Liu, Lei
supporting information; experimental part, p. 468 - 469 (2010/03/25)
(Chemical Equation Presented) Although nitrogen-containing group-directed cyclopalladation reactions have been well-known, Pd(II) insertion into C-H bonds promoted by coordination of an oxygen-only group to the palladium remains rather rare. In the present study, the first cyclopalladation complex formed from a simple phenol ester was characterized by X-ray crystallography. A promising protocol for the ortho C-H activation/aryl-aryl coupling of phenol esters that was not sensitive to moisture or air was then established. The utility of the reaction was demonstrated for the synthesis of useful phenol derivatives. Copyright