75403-23-5 Usage
Properties
1. Chemical formula: C12H13N
2. Appearance: Yellow liquid
3. Odor: Musky
4. Common uses: Flavor and fragrance industry
5. Found in: Perfumes, soaps, detergents, and tobacco smoke
6. Potential properties: Anti-cancer and anti-inflammatory
Specific content
Commonly used in the fragrance and flavor industry
Can be found in perfumes, soaps, and detergents
Identified as a compound with potential anti-cancer and anti-inflammatory properties
Should be handled with caution due to potential skin and eye irritation.
Check Digit Verification of cas no
The CAS Registry Mumber 75403-23-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,4,0 and 3 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 75403-23:
(7*7)+(6*5)+(5*4)+(4*0)+(3*3)+(2*2)+(1*3)=115
115 % 10 = 5
So 75403-23-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H13N/c1-3-10-5-7-12-11(8-10)6-4-9(2)13-12/h4-8H,3H2,1-2H3
