75655-44-6 Usage
Uses
Used in Pharmaceutical Industry:
1H-Benzimidazole-1-propanoic acid, 2,3-dihydro-2-oxois used as a building block for the synthesis of various pharmaceutical compounds. Its unique structure and properties make it a valuable component in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Research:
1H-Benzimidazole-1-propanoic acid, 2,3-dihydro-2-oxois used as a research tool in chemical laboratories. Its distinctive reactivity and structural features allow scientists to study various chemical reactions and mechanisms, contributing to the advancement of chemical knowledge and the discovery of new compounds.
Used in Material Science:
1H-Benzimidazole-1-propanoic acid, 2,3-dihydro-2-oxois used as a component in the development of new materials with specific properties. Its incorporation into polymers or other materials can result in materials with enhanced properties, such as improved stability, reactivity, or selectivity, which can be applied in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 75655-44-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,6,5 and 5 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 75655-44:
(7*7)+(6*5)+(5*6)+(4*5)+(3*5)+(2*4)+(1*4)=156
156 % 10 = 6
So 75655-44-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O3/c13-9(14)5-6-12-8-4-2-1-3-7(8)11-10(12)15/h1-4H,5-6H2,(H,11,15)(H,13,14)
75655-44-6Relevant academic research and scientific papers
SYNTHESIS OF N-CARBOXYALKYLBENZIMIDAZOLIN-2-ONES
Khalikov, S. S.,Kadyrov, Ch. Sh.,Ayupova, A. T.,Molchanov, L. V.
, p. 1251 - 1254 (2007/10/02)
The corresponding N-mono and N,N'-dicarboxyalkylbenzimidazolin-2-ones were prepared by the reaction of the sodium salts of benzimidazolin-2-one and its 1,5,6-substituted derivatives with chloroacetic acid, acrylonitrile. and γ-butyrolactone.
