75655-44-6 Usage
General Description
"1H-Benzimidazole-1-propanoic acid, 2,3-dihydro-2-oxo-" is a complex chemical compound that belongs to the class of benzimidazole and plays a distinctive role in various chemical reactions due to its unique structure and properties. It consists of a benzimidazole moiety, a biologically significant component that is present in a wide variety of natural and synthetic compounds, coupled with a propanoic acid moiety. The "2,3-dihydro-2-oxo-" indicates the presence of two additional hydrogen atoms, one oxygen atom, and a carbonyl group (-C=O) attached to the main molecule structure. 1H-Benzimidazole-1-propanoic acid, 2,3-dihydro-2-oxo- is typically used in molecular and applied chemistry. Specific chemical properties such as reactivity, acidity or basicity, and polarity depend on its structural framework and the presence of functional groups.
Check Digit Verification of cas no
The CAS Registry Mumber 75655-44-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,6,5 and 5 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 75655-44:
(7*7)+(6*5)+(5*6)+(4*5)+(3*5)+(2*4)+(1*4)=156
156 % 10 = 6
So 75655-44-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O3/c13-9(14)5-6-12-8-4-2-1-3-7(8)11-10(12)15/h1-4H,5-6H2,(H,11,15)(H,13,14)