76231-76-0 Usage
Description
ALPHA+BETA-THUJONE, also known as α,β-Thujone, is a compound found in the essential oil of Pistacia vera L. It is a monoterpene ketone with a unique molecular structure that contributes to its chemical properties and potential applications.
Uses
Used in Organic Synthesis:
ALPHA+BETA-THUJONE is used as a reactant in organic synthesis for various chemical reactions. Its unique structure allows it to participate in a range of reactions, making it a valuable component in the synthesis of various organic compounds.
Used in Aromatherapy:
ALPHA+BETA-THUJONE is used in aromatherapy as a component of essential oils. Its aromatic properties can provide a range of therapeutic benefits, such as promoting relaxation, reducing stress, and improving mood.
Used in Flavor and Fragrance Industry:
ALPHA+BETA-THUJONE is used as a flavoring agent and fragrance component in the food and cosmetics industries. Its distinct scent and taste can enhance the sensory experience of various products.
Used in Pharmaceutical Industry:
ALPHA+BETA-THUJONE has potential applications in the pharmaceutical industry as a starting material for the synthesis of various drugs. Its unique chemical properties make it a promising candidate for the development of new therapeutic agents.
Used in Pest Control:
ALPHA+BETA-THUJONE has been found to have insecticidal properties, making it a potential component in pest control products. Its ability to repel or kill insects can be utilized in the development of eco-friendly and effective pest control solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 76231-76-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,2,3 and 1 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 76231-76:
(7*7)+(6*6)+(5*2)+(4*3)+(3*1)+(2*7)+(1*6)=130
130 % 10 = 0
So 76231-76-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H16O/c1-6(2)10-4-8(10)7(3)9(11)5-10/h6-8H,4-5H2,1-3H3/t7?,8-,10+/m1/s1
76231-76-0Relevant articles and documents
A six-step total synthesis of α-thujone and: D 6-α-thujone, enabling facile access to isotopically labelled metabolites
Thamm, Irene,Richers, Johannes,Rychlik, Michael,Tiefenbacher, Konrad
, p. 11701 - 11703 (2016/10/04)
The short synthesis of α-thujone relies on the functionalization of the readily available dimethylfulvene. Furthermore, the three main metabolites of the natural product were also synthesized. Since d6-acetone can be used as a starting material, the route developed allows for the facile incorporation of isotopic labels which are required for detecting and quantifying trace amounts via GC/MS analysis.
