76260-78-1 Usage
General Description
The chemical compound "ARG-PRO-LYS-PRO-GLN-GLN-PHE-PHE-GLY-LEU-MET-OME" is a peptide composed of amino acids arranged in a specific sequence. It begins with the amino acids arginine (ARG), proline (PRO), lysine (LYS) and proline (PRO) followed by glutamine (GLN) repeated twice, then phenylalanine (PHE) also repeated twice, and ending with glycine (GLY), leucine (LEU) and methionine (MET) with an O-methyl (OME) group attached. This chemical compound is likely to have biological significance as peptides play crucial roles in various biological processes such as signal transduction, enzyme regulation, and cell communication.
Check Digit Verification of cas no
The CAS Registry Mumber 76260-78-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,2,6 and 0 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 76260-78:
(7*7)+(6*6)+(5*2)+(4*6)+(3*0)+(2*7)+(1*8)=141
141 % 10 = 1
So 76260-78-1 is a valid CAS Registry Number.
InChI:InChI=1/C63H97N17O14S/c1-37(2)33-45(56(87)76-44(27-32-95-4)62(93)94-3)72-52(83)36-71-53(84)46(34-38-15-7-5-8-16-38)77-57(88)47(35-39-17-9-6-10-18-39)78-55(86)41(22-24-50(66)81)73-54(85)42(23-25-51(67)82)74-58(89)49-21-14-31-80(49)61(92)43(19-11-12-28-64)75-59(90)48-20-13-30-79(48)60(91)40(65)26-29-70-63(68)69/h5-10,15-18,37,40-49H,11-14,19-36,64-65H2,1-4H3,(H2,66,81)(H2,67,82)(H,71,84)(H,72,83)(H,73,85)(H,74,89)(H,75,90)(H,76,87)(H,77,88)(H,78,86)(H4,68,69,70)/t40-,41-,42-,43-,44-,45-,46-,47-,48-,49-/m0/s1