76696-85-0 Usage
Uses
Used in Pharmaceutical Industry:
2,5,6,7-Tetrahydro-2-(2-(methylthio)ethyl)-6-phenyl-3H-pyrrolo(1,2-a)imidazol-3-one is used as a potential pharmaceutical candidate for the development of new drugs. Its unique molecular structure and properties make it a promising candidate for further exploration in medicinal chemistry research.
Used in Medicinal Chemistry Research:
2,5,6,7-Tetrahydro-2-(2-(methylthio)ethyl)-6-phenyl-3H-pyrrolo(1,2-a)imidazol-3-one is used as a subject of study in medicinal chemistry to understand its properties, interactions, and potential therapeutic applications. This research can lead to the discovery of new drugs and treatment methods.
Check Digit Verification of cas no
The CAS Registry Mumber 76696-85-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,6,9 and 6 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 76696-85:
(7*7)+(6*6)+(5*6)+(4*9)+(3*6)+(2*8)+(1*5)=190
190 % 10 = 0
So 76696-85-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H18N2OS/c1-19-8-7-13-15(18)17-10-12(9-14(17)16-13)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3
76696-85-0Relevant academic research and scientific papers
Synthese de nouvelles amidines bicyclique. 1. Derives de l'imidazole, du triazole-1,3,4 et du tetrazole
Langlois, Michel,Guillonneau, Claude,Van, Tri Vo,Meingan, Jean-Pierre,Maillard, Jacques
, p. 193 - 200 (2007/10/02)
The synthesis of pyrroloimidazoles, pyrrolotriazoles and pyrrolotetrazole is described.Several homologous compounds contain the pyridine or the azepine ring instead of the pyrrole ring.They were obtained from cyclic amidines, by means
