767-62-4 Usage
Uses
Used in Medicinal Chemistry:
[1,2,4]triazolo[4,3-a]pyridin-3-amine is used as a building block in the synthesis of various organic compounds for medicinal chemistry applications. Its unique structure allows it to serve as a scaffold for the development of novel drug candidates, potentially leading to the discovery of new therapeutic agents.
Used in Drug Discovery:
In the field of drug discovery, [1,2,4]triazolo[4,3-a]pyridin-3-amine is utilized for its potential pharmacological properties. Its ability to interact with biological targets makes it a valuable compound for the exploration of new therapeutic approaches and the advancement of existing treatments.
Used in Chemical Research:
[1,2,4]triazolo[4,3-a]pyridin-3-amine is also used in chemical research to study its specific properties and potential applications. Ongoing research and discovery in the field of chemistry aim to further understand the compound's characteristics and explore its potential uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 767-62-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,6 and 7 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 767-62:
(5*7)+(4*6)+(3*7)+(2*6)+(1*2)=94
94 % 10 = 4
So 767-62-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4/c7-6-9-8-5-3-1-2-4-10(5)6/h1-4H,(H2,7,9)
767-62-4Relevant academic research and scientific papers
Α 7 as intranuclear hydroxynicotinic acetylcholine receptor quinuclidines compd.
-
Paragraph 0507; 0509, (2018/10/03)
PROBLEM TO BE SOLVED: To provide ligands for the nicotinic α-7 receptor used for the treatment of various disorders of the central nervous system, especially affective and neurodegenerative disorders.SOLUTION: The disclosure provides compounds of the specified formula I, including their salts, and compositions and methods using the compounds.
Formation of nitrogen-containing heterocycles using di(imidazole-1-yl)methanimine
Wu, Yong-Qian,Limburg, David C.,Wilkinson, Douglas E.,Hamilton, Gregory S.
, p. 191 - 193 (2007/10/03)
A mild and efficient synthesis of five- and six-membered nitrogen containing heterocyclic compounds, in which di(imidazole-1-yl)methanimine serves as a one-carbon source, is reported.
