7675-46-9 Usage
Uses
Used in Organic Synthesis:
N-2-NITROPHENYLSULFENYL-L-ALANINE DICYCLOHEXYLAMMONIUM SALT is used as a chiral auxiliary for asymmetric synthesis in organic synthesis. Its unique structure allows for the selective formation of enantiomers, which is crucial in the production of chiral compounds with specific biological activities.
Used in Biochemical Research:
In biochemical research, N-2-NITROPHENYLSULFENYL-L-ALANINE DICYCLOHEXYLAMMONIUM SALT serves as a component in the preparation of peptide and protein fragments. Its incorporation into these biological molecules enables the study of their structure, function, and interactions with other molecules, contributing to a deeper understanding of biological processes.
Used in Pharmaceutical Research:
N-2-NITROPHENYLSULFENYL-L-ALANINE DICYCLOHEXYLAMMONIUM SALT has potential applications in pharmaceutical research, particularly in the development of new drugs and pharmaceutical intermediates. Its unique properties and reactivity make it a promising candidate for the synthesis of novel therapeutic agents with improved efficacy and selectivity.
Used in Drug Development:
In the pharmaceutical industry, N-2-NITROPHENYLSULFENYL-L-ALANINE DICYCLOHEXYLAMMONIUM SALT is used as a key intermediate in the synthesis of various drug candidates. Its versatility and reactivity in chemical reactions facilitate the development of new drugs with specific therapeutic targets and improved pharmacological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 7675-46-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,6,7 and 5 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 7675-46:
(6*7)+(5*6)+(4*7)+(3*5)+(2*4)+(1*6)=129
129 % 10 = 9
So 7675-46-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H23N.C9H10N2O4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-6(9(12)13)10-16-8-5-3-2-4-7(8)11(14)15/h11-13H,1-10H2;2-6,10H,1H3,(H,12,13)/t;6-/m.0/s1