773134-49-9 Usage
Uses
Used in Pharmaceutical Manufacturing:
7-methyl-1H-indole-3-carboxylic acid methyl ester is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows it to be a versatile building block for the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
7-methyl-1h-indole-3-carbpxylic acid methyl ester is used as a key component in the synthesis of other organic compounds, particularly those with biological activity. Its reactivity and functional groups make it a valuable precursor for the creation of novel molecules with potential applications in various fields.
Used in Antimicrobial Applications:
7-methyl-1H-indole-3-carboxylic acid methyl ester has been studied for its potential as an antimicrobial agent. Its ability to target and inhibit the growth of certain microorganisms makes it a promising candidate for the development of new antimicrobial drugs.
Used in Antiviral Applications:
7-methyl-1h-indole-3-carbpxylic acid methyl ester has also been investigated for its potential as an antiviral agent. Its unique chemical properties may allow it to interfere with viral replication or assembly, offering a new approach to treating viral infections.
Used in Anticancer Applications:
7-methyl-1H-indole-3-carboxylic acid methyl ester has been studied for its potential as an anticancer agent. Its ability to target and inhibit the growth of cancer cells, as well as its potential to enhance the effectiveness of existing cancer treatments, makes it a promising candidate for further research and development in oncology.
Used as a Precursor for the Synthesis of Bioactive Compounds:
Due to its unique chemical structure and potential biological activity, 7-methyl-1H-indole-3-carboxylic acid methyl ester serves as a valuable precursor for the synthesis of other bioactive compounds. This allows researchers to explore its potential applications in various fields, including medicine, agriculture, and environmental science.
Check Digit Verification of cas no
The CAS Registry Mumber 773134-49-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,3,1,3 and 4 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 773134-49:
(8*7)+(7*7)+(6*3)+(5*1)+(4*3)+(3*4)+(2*4)+(1*9)=169
169 % 10 = 9
So 773134-49-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO2/c1-7-4-3-5-8-9(11(13)14-2)6-12-10(7)8/h3-6,12H,1-2H3
773134-49-9Relevant academic research and scientific papers
A New Method for the Synthesis of 3-Substituted Indoles
Natarajan, Rakesh,Rappai, John P.,Unnikrishnan, Peruparampil A.,Radhamani, Sandhya,Prathapan, Sreedharan
supporting information, p. 2467 - 2471 (2015/10/19)
Starting from readily accessible nitrones and electron-deficient acetylenes, a highly efficient and versatile synthetic protocol for 3-substituted indoles has been developed.
