77402-03-0 Usage
Uses
Used in Polymer Synthesis Industry:
MAGME is used as a monomer for the synthesis of self-crosslinking polymers. Its ability to form crosslinks within the polymer matrix contributes to the development of materials with enhanced mechanical properties, stability, and performance.
In the synthesis of self-crosslinking polymers, MAGME serves as a key component that enables the formation of a three-dimensional network structure. This network structure is crucial for improving the overall properties of the polymer, such as its strength, flexibility, and resistance to environmental factors.
The use of MAGME in polymer synthesis allows for the creation of materials that can be tailored to specific applications, such as coatings, adhesives, and sealants. These materials can exhibit improved adhesion, durability, and resistance to various environmental conditions, making them ideal for use in a wide range of industries, including construction, automotive, and aerospace.
Furthermore, the self-crosslinking nature of polymers synthesized with MAGME can lead to reduced curing times and lower energy consumption during the manufacturing process. This can result in more cost-effective and environmentally friendly production methods.
Check Digit Verification of cas no
The CAS Registry Mumber 77402-03-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,4,0 and 2 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 77402-03:
(7*7)+(6*7)+(5*4)+(4*0)+(3*2)+(2*0)+(1*3)=120
120 % 10 = 0
So 77402-03-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO4/c1-4-5(9)8-6(11-2)7(10)12-3/h4,6H,1H2,2-3H3,(H,8,9)
77402-03-0Relevant academic research and scientific papers
Preparation of alkyl acrylamidoglycolates and their alkyl ethers
-
, (2008/06/13)
Reaction of an acrylamide with an alkyl glyoxylate or an alkyl glyoxylate hemiacetal provides an alkyl acrylamidoglycolate which can readily be alkylated to provide the alkyl ether thereof.
Polyfunctional amine crosslinker, process for making same, and compositions containing same
-
, (2008/06/13)
A sterically unhindered, trifunctional primary amine is provided. This compound is useful as a crosslinking agent for a composition containing an amine-reactive polymer. Also provided is a low temperature cure composition containing the amine-reactive polymer and the trifunctional primary amine, and a crosslinked coating obtained by curing such a composition. Additionally, there is provided a process of synthesizing the novel trifunctional primary amine.
Ethers of acrylamidoglycolic acid and esters
-
, (2008/06/13)
Ethylenically unsaturated monomers containing activated ester groups are used to make polymers and copolymers which are useful in coatings, adhesives and moldings.
