77602-73-4 Usage
General Description
(Z)-2-Chloro-6-hydroxy-9-(3-dimethylaminopropylidene)thioxanthene is a chemical compound that contains a thioxanthene core structure. It is characterized by the presence of a chlorine atom at the 2 position and a hydroxyl group at the 6 position. Additionally, it features a 3-dimethylaminopropylidene substituent at the 9 position. This chemical compound may have potential pharmaceutical applications due to its unique structure and properties, which could potentially be explored for their therapeutic effects in the future. Therefore, further research and studies are warranted to fully understand the potential uses of (Z)-2-Chloro-6-hydroxy-9-(3-dimethylaminopropylidene)thioxanthene in various fields, including medicine and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 77602-73-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,6,0 and 2 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 77602-73:
(7*7)+(6*7)+(5*6)+(4*0)+(3*2)+(2*7)+(1*3)=144
144 % 10 = 4
So 77602-73-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H18ClNOS/c1-20(2)9-3-4-14-15-7-6-13(21)11-18(15)22-17-8-5-12(19)10-16(14)17/h4-8,10-11,21H,3,9H2,1-2H3/b14-4-
