780-00-7 Usage
Uses
Used in Organic Synthesis:
3,5-DIIODO-4-HYDROXYPHENYLPYRUVIC ACID is used as a synthetic building block for the development of new organic compounds. Its unique structure allows it to be a valuable intermediate in the synthesis of various pharmaceuticals, agrochemicals, and other specialty chemicals. The presence of the iodine atoms and the hydroxyl group in the molecule makes it a versatile and reactive intermediate for further chemical modifications and functionalization.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3,5-DIIODO-4-HYDROXYPHENYLPYRUVIC ACID is used as a key intermediate in the synthesis of drugs targeting specific diseases. Its unique structure and reactivity enable the development of novel therapeutic agents with improved efficacy and selectivity. 3,5-DIIODO-4-HYDROXYPHENYLPYRUVIC ACID's potential applications in drug discovery and development make it an important tool for medicinal chemists and researchers in the pharmaceutical sector.
Used in Research and Development:
3,5-DIIODO-4-HYDROXYPHENYLPYRUVIC ACID is also utilized in research and development laboratories for studying various chemical reactions and exploring new synthetic routes. Its unique properties make it an interesting subject for academic and industrial research, leading to the discovery of new compounds and applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 780-00-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,8 and 0 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 780-00:
(5*7)+(4*8)+(3*0)+(2*0)+(1*0)=67
67 % 10 = 7
So 780-00-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H6I2O4/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,13H,3H2,(H,14,15)
