78069-08-6 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
METHYL 4-(2-OXOPROPYL)PHENOXYACETATE is utilized as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique chemical structure allows it to serve as a building block for the development of new drugs and pesticides, contributing to advancements in these industries.
Used as a Flavoring Agent in the Food Industry:
In the food industry, METHYL 4-(2-OXOPROPYL)PHENOXYACETATE is employed as a flavoring agent. Its distinctive taste profile can enhance the flavor of various food products, providing a unique and appealing taste experience for consumers.
Used as a Fragrance Ingredient in the Cosmetic Industry:
METHYL 4-(2-OXOPROPYL)PHENOXYACETATE also finds application in the cosmetic industry as a fragrance ingredient. Its aromatic properties can be incorporated into various cosmetic products, such as perfumes, lotions, and creams, to provide a pleasant and long-lasting scent.
Used in Organic Synthesis and Material Science:
Due to its unique chemical structure, METHYL 4-(2-OXOPROPYL)PHENOXYACETATE may have potential applications in the field of organic synthesis and material science. It can be used as a starting material or a component in the development of new organic compounds and materials with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 78069-08-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,0,6 and 9 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 78069-08:
(7*7)+(6*8)+(5*0)+(4*6)+(3*9)+(2*0)+(1*8)=156
156 % 10 = 6
So 78069-08-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H14O4/c1-9(13)7-10-5-3-4-6-11(10)16-8-12(14)15-2/h3-6H,7-8H2,1-2H3
78069-08-6Relevant academic research and scientific papers
Ethanamine derivatives their preparation and use in pharmaceutical compositions
-
, (2008/06/13)
The compounds of formula (II): STR1 in which R1 is a hydrogen, fluorine, chlorine or bromine atom or a hydroxyl, hydroxymethyl, methyl, methoxyl, amino, formamido, acetamido, methylsulphonylamido, nitro, benzyloxy, methylsulphonylmethyl, ureido, trifluoromethyl or p-methoxybenzylamino group; R2 is a hydrogen, fluorine, chlorine or bromine atom or a hydroxyl group; R3 is a hydrogen, chlorine or bromine atom or a hydroxyl group, R4 is a hydrogen atom or a methyl group; R5 is a hydrogen atom or a methyl group; R6 is a hydrogen, fluorine or chlorine atom or a methyl, methoxyl or hydroxy group; X is an oxygen atom or a bond; Y is an alkylene group of up to 6 carbon atoms or a bond; and Z is an alkylene, alkenylene or alkynylene group of up to 10 carbon atoms, have been found to possess anti-obesity and/or anti-hyperglycaemic activity.
