78425-12-4 Usage
Description
[3-(1H-PYRAZOL-1-YLMETHYL)PHENYL]METHANOL is a chemical compound characterized by its molecular formula C14H14N2O. It is a white to off-white solid that exhibits sparing solubility in water. This versatile chemical is known for its unique chemical structure, which makes it a valuable building block in the synthesis of pharmaceuticals and agrochemicals. Due to its potential applications in developing new materials, it holds promise in the field of chemistry. However, it is crucial to handle this compound with care, as it may pose risks to human health and the environment if mismanaged.
Uses
Used in Pharmaceutical Industry:
[3-(1H-PYRAZOL-1-YLMETHYL)PHENYL]METHANOL is used as a key building block for the synthesis of various pharmaceuticals. Its unique structure allows it to be incorporated into the development of new drugs, potentially leading to innovative treatments and therapies.
Used in Agrochemical Industry:
In the agrochemical sector, [3-(1H-PYRAZOL-1-YLMETHYL)PHENYL]METHANOL serves as a fundamental component in the creation of new agrochemicals. Its integration into the development process can contribute to the advancement of more effective and environmentally friendly products for agricultural use.
Used in Material Science:
[3-(1H-PYRAZOL-1-YLMETHYL)PHENYL]METHANOL is utilized in the field of material science for the development of new materials. Its distinctive chemical structure lends itself to the creation of innovative materials with unique properties, potentially revolutionizing various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 78425-12-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,4,2 and 5 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 78425-12:
(7*7)+(6*8)+(5*4)+(4*2)+(3*5)+(2*1)+(1*2)=144
144 % 10 = 4
So 78425-12-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O/c14-9-11-4-1-3-10(7-11)8-13-6-2-5-12-13/h1-7,14H,8-9H2
78425-12-4Relevant articles and documents
HETEROCYCLIC INHIBITORS OF GLUTAMINASE
-
Page/Page column 105; 106, (2013/06/06)
The invention relates to the heterocyclic compounds of Formula (I) as defined further herein, and pharmaceutical preparations thereof. The invention further relates to methods of treating cancer, immunological or neurological diseases using the heterocyclic compounds of the invention.
