787580-87-4 Usage
Uses
Used in Pharmaceutical Industry:
4-CHLORO-3-HYDROXY 1H-INDAZOLE is used as a key intermediate in the development of novel drugs and therapeutic agents, leveraging its unique chemical properties to create innovative pharmaceutical compounds.
Used in Chemical Research and Synthesis:
4-CHLORO-3-HYDROXY 1H-INDAZOLE is utilized as a valuable chemical entity in chemical research and synthesis, owing to its diverse reactivity and structural properties that facilitate the exploration of new chemical reactions and the synthesis of various compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 787580-87-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,8,7,5,8 and 0 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 787580-87:
(8*7)+(7*8)+(6*7)+(5*5)+(4*8)+(3*0)+(2*8)+(1*7)=234
234 % 10 = 4
So 787580-87-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H5ClN2O/c8-4-2-1-3-5-6(4)7(11)10-9-5/h1-3H,(H2,9,10,11)
