79055-52-0 Usage
Uses
Used in Pharmaceutical Industry:
2,4-DIBROMO-6-METHYLPYRIDINE is used as a chemical intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique structure allows for the creation of molecules with specific properties that can be tailored for medicinal applications.
Used in Agrochemical Industry:
In the agrochemical sector, 2,4-DIBROMO-6-METHYLPYRIDINE serves as an intermediate in the production of agrochemicals, such as pesticides and herbicides. Its role in these applications is crucial for enhancing crop protection and improving agricultural yields.
Used in Fine Chemicals Synthesis:
2,4-DIBROMO-6-METHYLPYRIDINE is also utilized in the synthesis of fine chemicals, which are high-purity chemicals used in various industries, including fragrances, flavors, and specialty chemicals. Its versatility in molecular construction is essential for creating high-quality products in these markets.
Used in Research and Development:
2,4-DIBROMO-6-METHYLPYRIDINE is employed in research and development activities within the pharmaceutical and agrochemical industries. It aids scientists in exploring new chemical reactions and developing innovative products, thus playing a significant role in advancing scientific knowledge and technological progress.
It is imperative to handle 2,4-DIBROMO-6-METHYLPYRIDINE with caution due to potential hazards associated with its chemical properties. Proper management and safety measures are essential to mitigate any risks during its use in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 79055-52-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,0,5 and 5 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 79055-52:
(7*7)+(6*9)+(5*0)+(4*5)+(3*5)+(2*5)+(1*2)=150
150 % 10 = 0
So 79055-52-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H5Br2N/c1-4-2-5(7)3-6(8)9-4/h2-3H,1H3
79055-52-0Relevant academic research and scientific papers
AMINOPYRROLIDINE COMPOUND
-
Page/Page column 60, (2009/01/24)
Disclosed is an aminopyrrolidine compound represented by the formula [I] or a pharmaceutically acceptable salt thereof. The compound or the salt is useful as a prophylactic/therapeutic agent for mode disorder such as depression, anxiety disorder, anorexia, cachexia, pain and drug dependence, whose action relies on the MC4 receptor antagonistic effect.
