794569-03-2 Usage
Uses
Used in Pharmaceutical Research:
(4-METHYL-PYRIDIN-3-YL)-HYDRAZINE is used as a chemical intermediate for the synthesis of various pharmaceutical compounds due to its reactive functional groups and unique structure, which can be further modified to create new drug molecules.
Used in Material Science:
In the field of material science, (4-METHYL-PYRIDIN-3-YL)-HYDRAZINE is utilized as a building block for the development of novel materials with specific properties, such as conductivity or catalytic activity, owing to its ability to engage in various chemical reactions.
Used in Chemical Synthesis:
(4-METHYL-PYRIDIN-3-YL)-HYDRAZINE serves as a key component in the synthesis of complex organic molecules, where its pyridine and hydrazine functionalities can be exploited to form new chemical bonds and structures.
Check Digit Verification of cas no
The CAS Registry Mumber 794569-03-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,9,4,5,6 and 9 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 794569-03:
(8*7)+(7*9)+(6*4)+(5*5)+(4*6)+(3*9)+(2*0)+(1*3)=222
222 % 10 = 2
So 794569-03-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H9N3/c1-5-2-3-8-4-6(5)9-7/h2-4,9H,7H2,1H3
794569-03-2Relevant academic research and scientific papers
6-Cyclylmethyl- and 6-alkylmethyl-substituted pyrazolepyrimidines
-
, (2008/06/13)
The invention relates to novel 6-cyclylmethyl- and 6-alkylmethyl-substituted pyrazolopyrimidines, process for their preparation and their use for producing medicaments for improving perception, concentration, learning and/or memory.
6-CYCLYLMETHYL- AND 6-ALKYLMETHYL-SUBSTITUTED PYRAZOLOPYRIMIDINES
-
Page/Page column 46, (2008/06/13)
The invention relates to novel 6-cyclylmethyl- and 6-alkylmethyl-substituted pyrazolopyrimidines, method for production and use thereof for the production of medicaments for the improvement of cognition, concentration, learning and/or memory capacity.
