80862-08-4 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
6-Methoxy-5-azaindole is utilized as a potential anti-cancer agent, exhibiting biological activities that make it a promising candidate for cancer treatment. Its unique structure allows it to modulate various cellular pathways, potentially leading to the inhibition of tumor growth and progression.
Additionally, 6-Methoxy-5-azaindole serves as a valuable building block for the synthesis of various biologically active compounds, contributing to the development of novel pharmaceuticals with diverse therapeutic applications.
Used in Organic Synthesis:
As an intermediate in the preparation of complex organic molecules, 6-Methoxy-5-azaindole plays a crucial role in the synthesis of a wide range of chemical compounds. Its unique structural features enable the creation of new molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 80862-08-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,8,6 and 2 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 80862-08:
(7*8)+(6*0)+(5*8)+(4*6)+(3*2)+(2*0)+(1*8)=134
134 % 10 = 4
So 80862-08-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2O/c1-11-8-4-7-6(5-10-8)2-3-9-7/h2-5,9H,1H3
80862-08-4Relevant academic research and scientific papers
PPAR ACTIVE COMPOUNDS
-
Page 177-178, (2008/06/13)
Compounds are described that are active on PPARs, including pan-active compounds. Also described are methods for developing or identifying compounds having a desired selectivity profile.
AZAINDOLE DERIVATIVES. 60. NUCLEOPHILIC SUBSTITUTION REACTIONS IN 6-CHLORO-5-AZAINDOLINES
Azimov, V. A.,Bychikhina, N. N.,Yakhontov, L. N.
, p. 1208 - 1213 (2007/10/02)
Reactions involving nucleophilic substitution of the halogen atoms in 1-benzyl-6-chloro-7-cyano-5-azaindoline by alkoxy groups and residues of varios amines were investigated.The effect of electron acceptor substituents on the saponification of the alkoxy
