81409-86-1 Usage
General Description
"(8-beta)-N-Cyclohexyl-N-((cyclohexylamino)carbonyl)-6-(2-propenyl)ergo line-8-carboxamide" is a chemical compound with a complex structure that includes a cyclohexyl and 2-propenyl group attached to an ergoline ring. The compound is classified as an ergoline derivative and is a semi-synthetic analog of ergoline alkaloids, which are naturally occurring compounds found in various fungi and plants. This specific compound is commonly used in research and pharmaceutical development, particularly in the study of neurological disorders and as a potential treatment for conditions such as migraines and Parkinson's disease. Its chemical structure suggests potential interactions with various neurotransmitter systems in the brain, making it a promising candidate for further investigation and potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 81409-86-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,4,0 and 9 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 81409-86:
(7*8)+(6*1)+(5*4)+(4*0)+(3*9)+(2*8)+(1*6)=131
131 % 10 = 1
So 81409-86-1 is a valid CAS Registry Number.
InChI:InChI=1/C31H42N4O2/c1-2-16-34-20-22(17-26-25-14-9-15-27-29(25)21(19-32-27)18-28(26)34)30(36)35(24-12-7-4-8-13-24)31(37)33-23-10-5-3-6-11-23/h2,9,14-15,19,22-24,26,28,32H,1,3-8,10-13,16-18,20H2,(H,33,37)/t22-,26?,28-/m1/s1