82087-73-8 Usage
General Description
The chemical compound (2S,4S)-4-benzyl-pyrrolidine-2-carboxylic acid is a derivative of the amino acid proline and belongs to the class of pyrrolidine carboxylic acids. It contains a pyrrolidine ring with a benzyl group attached to the fourth carbon and a carboxylic acid group attached to the second carbon. (2S,4S)-4-BENZYL-PYRROLIDINE-2-CARBOXYLIC ACID has potential applications in medicinal chemistry and drug development due to its ability to interact with biological systems and modify their activity. Additionally, it may also be utilized in the synthesis of other organic compounds with specific structural and functional properties.
Check Digit Verification of cas no
The CAS Registry Mumber 82087-73-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,0,8 and 7 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 82087-73:
(7*8)+(6*2)+(5*0)+(4*8)+(3*7)+(2*7)+(1*3)=138
138 % 10 = 8
So 82087-73-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO2/c14-12(15)11-7-10(8-13-11)6-9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2,(H,14,15)/t10-,11-/m0/s1