82437-74-9

Usage

Uses

Used in Pharmaceutical Research:
4-(4-Methoxyphenyl)thiophene-2-carboxylic acid is used as a building block for the synthesis of various biologically active molecules, such as antifungal and antitumor agents. Its unique structure and functional groups contribute to the development of new drugs with improved therapeutic properties.
Used in Agrochemical Research:
In the agrochemical industry, 4-(4-Methoxyphenyl)thiophene-2-carboxylic acid is used as a precursor for the synthesis of compounds with pesticidal properties. Its potential biological activities make it a valuable component in the development of new agrochemicals for crop protection.
Used as a Corrosion Inhibitor:
4-(4-Methoxyphenyl)thiophene-2-carboxylic acid demonstrates promising potential as a corrosion inhibitor. Its ability to form protective films on metal surfaces helps prevent corrosion, making it a valuable additive in various industrial applications, such as in the manufacturing of coatings and lubricants.
Used as a Fluorescence Probe:
In biochemical and environmental analyses, 4-(4-Methoxyphenyl)thiophene-2-carboxylic acid serves as a fluorescence probe. Its optical properties allow for the detection and monitoring of specific molecules or environmental conditions, contributing to advancements in scientific research and environmental monitoring.

InChI:InChI=1/C12H10O3S/c1-15-10-4-2-8(3-5-10)9-6-11(12(13)14)16-7-9/h2-7H,1H3,(H,13,14)

Upstream product

• 1028277-43-1 [1-Methoxycarbonylmethylsulfanyl-2-(4-methoxy-phenyl)-3-oxo-propylsulfanyl]-acetic acid methyl ester 
• 53868-40-9 4-methoxyphenylmalondialdehyde 
• 82437-73-8 4-(4-Methoxy-phenyl)-thiophene-2-carboxylic acid methyl ester 
• 82437-65-8 methyl 3-amino-4-(4-methoxyphenyl)-2-thiophenecarboxylate 
• 53283-60-6 α-Hydroxymethyl-4-methoxy-phenylacetonitril 
• 104-47-2 p-methoxybenzylnitrile 

Downstream Products

• 82437-75-0 3-(4-methoxy-phenyl)-thiophene 

Relevant academic research and scientific papers

Novel thiophene derivatives, their process of preparation and the pharmaceutical compositions which comprise them

A compound of formula (I) selected from: wherein: X represents oxygen or sulphur, Y represents oxygen, —NH— or —N(C1-C6)alkyl-, Ra represents hydrogen, halogen, (C1-C3)alkyl, hydroxyl or (C1-C3)alkoxy, Rb represents hydrogen, halogen or (C1-C3)alkyl, A represents phenyl, pyridyl, (C5-C6)cycloalkyl or (C5-C6)cycloalkenyl, R1 and R2 each represent a group selected from hydrogen, halogen, cyano, nitro, haloalkyl, haloalkoxy, alkyl, alkenyl, alkynyl, —OR4, —NR4R5, —S(O)nR4, —C(O)R4, —CO2R4, —O—C(O)R4, —C(O)NR4R5, —NR5—C(O)R4, —NR5—SO2R4, -T-CN, -T-OR4, -T-OCF3, -T- NR4R5, -T-S(O)nR4, -T-C(O)R4, -T-CO2R4, -T-O—C(O)R4, -T-C(O)NR4R5, -T-NR4—C(O)R5, -T-NR4—SO2R5, —R6 and -T-R6 in which n, T, R4, R5 and R6 are as defined in the description, R3 represents an —R7 or —U—R11 group in which R7 represents hydrogen, alkyl, aryl, cycloalkyl or heterocycle, U represents a linear or branched alkylene chain and R11 is defined in the description, their optical isomers or their addition salts with a pharmaceutically acceptable acid or base, and their use as inhibitor of metalloproteinase and more specifically of metalloproteinase-12.

Synthese d'amino-3 thiophenes a partir d'aryl- et d'hetaryl-acetonitrile (1)

Applying Fiesselman's condensation to α-hydroxymethylene nitriles the authors describe a synthesis of substituted aminothiophenes.