82668-20-0 Usage
Uses
Used in Flavoring Industry:
2-chloro-4-hydroxy-3-methoxy-benzaldehyde is used as a flavoring agent for its sweet, vanilla-like aroma in food, beverages, and pharmaceutical products. It enhances the taste and aroma of these products, making them more appealing to consumers.
Used in Perfumery Industry:
2-chloro-4-hydroxy-3-methoxy-benzaldehyde is used as a fragrance ingredient in the production of perfumes. Its sweet, vanilla-like scent adds depth and complexity to perfume compositions, creating a pleasant and long-lasting olfactory experience.
Used as a Precursor in Pharmaceutical Synthesis:
2-chloro-4-hydroxy-3-methoxy-benzaldehyde serves as a key precursor in the synthesis of various pharmaceuticals and fine chemicals. Its unique chemical structure allows for the development of new and innovative drugs with potential therapeutic applications.
Used as a Precursor in Fine Chemicals Synthesis:
In the fine chemicals industry, 2-chloro-4-hydroxy-3-methoxy-benzaldehyde is used as a precursor for the synthesis of specialty chemicals with specific applications in various fields, such as dyes, pigments, and other industrial chemicals.
Safety Considerations:
2-chloro-4-hydroxy-3-methoxy-benzaldehyde is considered a safe additive and is approved for use in various countries as a food flavoring. However, it is essential to follow proper safety guidelines and avoid prolonged exposure to high concentrations, as it may cause irritation to the skin, eyes, and respiratory tract.
Check Digit Verification of cas no
The CAS Registry Mumber 82668-20-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,6,6 and 8 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 82668-20:
(7*8)+(6*2)+(5*6)+(4*6)+(3*8)+(2*2)+(1*0)=150
150 % 10 = 0
So 82668-20-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H7ClO3/c1-12-8-6(11)3-2-5(4-10)7(8)9/h2-4,11H,1H3
