83408-78-0 Usage
Uses
Used in Pharmaceutical Research:
((3-Methylphenyl)amino)ethanethioic acid S-1H-benzimidazol-2-yl ester is used as a building block or intermediate for the synthesis of other organic compounds in pharmaceutical research. Its benzimidazole structure and thioester functional group may contribute to the development of new drugs with potential therapeutic applications.
Used in Chemical Synthesis:
((3-Methylphenyl)amino)ethanethioic acid S-1H-benzimidazol-2-yl ester is used as a chemical intermediate in the synthesis of various organic compounds. Its unique structure and functional groups can be utilized to create new molecules with specific properties and potential applications in different industries.
Note: The specific applications and industries for ((3-Methylphenyl)amino)ethanethioic acid S-1H-benzimidazol-2-yl ester are not provided in the materials. The uses mentioned above are general and based on the information given about the compound's structure and potential in pharmaceutical research and chemical synthesis. Further research and testing would be required to determine its specific applications and effects on the human body.
Check Digit Verification of cas no
The CAS Registry Mumber 83408-78-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,4,0 and 8 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 83408-78:
(7*8)+(6*3)+(5*4)+(4*0)+(3*8)+(2*7)+(1*8)=140
140 % 10 = 0
So 83408-78-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H15N3OS/c1-11-5-4-6-12(9-11)17-10-15(20)21-16-18-13-7-2-3-8-14(13)19-16/h2-9,17H,10H2,1H3,(H,18,19)
83408-78-0Relevant academic research and scientific papers
Synthesis and CNS Activity of 2-(N-Arylaminoacetylmercapto)- and 2-(N-Arylacetamidomercapto)-benzimidazoles
Tripathi, Shephali,Ahmad, Shakeel,Barthwal, J. P.,Kishor, K.,Tangri, K. K.,Bhargava, K. P.
, p. 379 - 380 (2007/10/02)
The title mercaptobenzimidazoles (1a-t) have been synthesised and screened for their anticonvulsant and monoamine oxidase (MAO) inhibitory activities.Some of the compounds provide 80percent protection against pentylenetetrazole-induced convulsions and max
