83646-41-7 Usage
Uses
Used in Dye Synthesis:
Julolidine hydrobromide is used as an intermediate in the synthesis of [4-(2,3,6,7-tetrahydro-1H,5H-pyrido[3,2,1-ij]quinolin-9-ylazo)-phenyl]-methanol azodye. This azodye is a type of organic compound that exhibits unique optical properties, such as absorption and fluorescence, making it useful in various applications, including as a dye in analytical chemistry and as a fluorescent probe in biological research.
Used in Organic Synthesis:
Julolidine hydrobromide is also used as a building block in the synthesis of other organic compounds, such as pharmaceuticals, agrochemicals, and functional materials. Its unique tricyclic structure and reactivity make it a versatile intermediate for the development of new molecules with potential applications in various industries.
Used in Fluorescent Probes:
Due to its inherent blue fluorescence, julolidine hydrobromide can be used as a fluorescent probe in various analytical techniques, such as fluorescence spectroscopy and microscopy. This allows for the detection and imaging of specific molecules or structures in complex samples, providing valuable information about their properties and interactions.
Check Digit Verification of cas no
The CAS Registry Mumber 83646-41-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,6,4 and 6 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 83646-41:
(7*8)+(6*3)+(5*6)+(4*4)+(3*6)+(2*4)+(1*1)=147
147 % 10 = 7
So 83646-41-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N.BrH/c1-4-10-6-2-8-13-9-3-7-11(5-1)12(10)13;/h1,4-5H,2-3,6-9H2;1H
