83674-70-8 Usage
Uses
Used in Organic Synthesis:
2,3-Diiodo-pyridine is utilized as a key intermediate in organic synthesis for the creation of various complex organic molecules. Its unique structure allows for a range of chemical reactions, making it a valuable component in the synthesis of specialty chemicals and pharmaceuticals.
Used in Chemical Reactions as a Reagent:
In the realm of chemical reactions, 2,3-diiodo-pyridine serves as a reagent, particularly in processes that require halogenation. Its ability to participate in such reactions is instrumental in the formation of new chemical entities with potential applications in various industries.
Used in Medicinal Chemistry:
2,3-Diiodo-pyridine is explored in medicinal chemistry as a potential building block for the development of pharmaceutical compounds. Its structural features and reactivity make it a candidate for the creation of new drugs with specific therapeutic properties.
Used in Pharmaceutical Compounds Synthesis:
As a component in the synthesis of pharmaceutical compounds, 2,3-diiodo-pyridine contributes to the development of novel medications. Its presence in these compounds can influence their pharmacological activity, potentially leading to advancements in treatment options for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 83674-70-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,6,7 and 4 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 83674-70:
(7*8)+(6*3)+(5*6)+(4*7)+(3*4)+(2*7)+(1*0)=158
158 % 10 = 8
So 83674-70-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H3I2N/c6-4-2-1-3-8-5(4)7/h1-3H
83674-70-8Relevant academic research and scientific papers
Studies on Organometallic Compounds. II. Facile and Convenient Method for the Synthesis of Idoazines through Iododestannation of Trimethylstannylazines
Yamamoto, Yukata,Yanagi, Akihiko
, p. 1731 - 1737 (2007/10/02)
Trimethylsatannyl and bis(trimethylstannyl) derivatives of pyridine, quinoline, and isoquinoline were prepared from the corresponding halo and dihalo (chloro or bromo) derivatives and trimethylstannyl sodium, which was generated in situ from chlorotrimethylsatannane and sodium.These stannyl derivatives readily underwent iododestannation on treatment with iodine to produce the corresponding iodo and diiodo derivatives of pyridine, quinoline, and isoquinoline, respectively, in good yields.Keywords -trimethylsannylazine; bis(trimethylstannyl)azine; iodoazine; diiodoazine; iododestannation; trimethylstannyl sodium; chlorotrimethylstannane
