837-73-0 Usage
Uses
Used in Pharmaceutical Industry:
3,6-diamino-10-methylacridinium is used as a pharmaceutical compound for its potential therapeutic properties. The methylation at position 10 may confer specific biological activities, making it a candidate for the development of new drugs with improved efficacy and reduced side effects.
Used in Chemical Research:
3,6-diamino-10-methylacridinium is used as a research chemical for studying the effects of structural modifications on the properties and behavior of acridine-based compounds. This knowledge can be applied to the design of new molecules with tailored characteristics for various applications, such as drug development, materials science, or environmental remediation.
Used in Analytical Chemistry:
3,6-diamino-10-methylacridinium can be employed as a reagent or analytical tool in various chemical assays and techniques. Its unique chemical structure may enable selective detection, quantification, or manipulation of target molecules, contributing to the advancement of analytical methods and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 837-73-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,3 and 7 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 837-73:
(5*8)+(4*3)+(3*7)+(2*7)+(1*3)=90
90 % 10 = 0
So 837-73-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H13N3.H2O4S/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;1-5(2,3)4/h2-8H,1H3,(H3,15,16);(H2,1,2,3,4)
