84-43-5 Usage
Uses
Used in Pharmaceutical and Medicinal Chemistry:
2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid is used as a pharmaceutical and medicinal chemistry compound for its potential biological activities. Its unique structure allows for interactions with various biological targets, offering opportunities for the development of new therapeutic agents.
Used in Organic Synthesis:
In the field of organic synthesis, 2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid serves as a valuable intermediate or building block for the synthesis of more complex organic molecules. Its aromatic and functional group properties enable the formation of diverse chemical entities with potential applications in various industries.
Used in Material Science:
2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid is utilized in material science for its potential to contribute to the development of new materials with unique properties. Its aromatic and functional group characteristics can be exploited to create materials with enhanced performance in areas such as electronics, optoelectronics, and nanotechnology.
Further research and study are required to fully explore the potential applications and properties of 2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid, unlocking its full potential in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 84-43-5 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 8 and 4 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 84-43:
(4*8)+(3*4)+(2*4)+(1*3)=55
55 % 10 = 5
So 84-43-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H11NO3/c19-15-8-12-9(7-13(15)17(20)21)5-6-11-10-3-1-2-4-14(10)18-16(11)12/h1-8,18-19H,(H,20,21)
