84260-33-3 Usage
Structure
Cyclic structure containing a silicon, sulfur, and nitrogen atom
Usage
Building block in the synthesis of other organic and inorganic compounds and materials
Applications
Organosilicon chemistry and pharmaceutical research
Health risks
Can cause skin irritation, eye contact, and inhalation hazards if not handled and stored properly.
Check Digit Verification of cas no
The CAS Registry Mumber 84260-33-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,6 and 0 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 84260-33:
(7*8)+(6*4)+(5*2)+(4*6)+(3*0)+(2*3)+(1*3)=123
123 % 10 = 3
So 84260-33-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H17NSSi/c1-4-10(5-2)8-6-7(3)9-10/h7-8H,4-6H2,1-3H3
