84460-95-7 Usage
Explanation
The chemical formula represents the compound's composition, which includes carbon (C), hydrogen (H), nitrogen (N), oxygen (O), and sulfur (S).
Explanation
The unique identifier for the compound in chemical databases.
Explanation
Describes the physical appearance of the compound.
Explanation
The mass of one mole of the compound.
Explanation
The primary applications of the compound in various industries.
Explanation
The temperature range at which the compound transitions from a solid to a liquid state.
Explanation
The compound can dissolve in both water and certain organic solvents, making it useful in various chemical reactions and processes.
Explanation
Handling the compound requires care due to its potential to cause irritation to the skin, eyes, and respiratory system.
Explanation
The structural formula provides information about the arrangement of atoms within the compound, including the positions of hydrogen (H) atoms and the presence of various functional groups.
Appearance
White, crystalline solid
Molecular Weight
179.28 g/mol
Uses
Synthesis of pharmaceuticals (antibiotics, antifungal agents), rubber and plastic additives
Melting Point
198-200°C
Solubility
Soluble in water and organic solvents
Safety Precautions
Potential skin, eye, and respiratory system irritation
Check Digit Verification of cas no
The CAS Registry Mumber 84460-95-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,4,6 and 0 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 84460-95:
(7*8)+(6*4)+(5*4)+(4*6)+(3*0)+(2*9)+(1*5)=147
147 % 10 = 7
So 84460-95-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H9N3OS2/c1-3-11-6-9-8-5(12-6)7-4(2)10/h3H2,1-2H3,(H,7,8,10)
84460-95-7Relevant articles and documents
Regiospecific alkylation of 5-substituted 2-acylamino-1, 3,4-thiadiazoles
Choo, Nam Sook,Hwang, Hye Jeong,Kim, Jin-Gyu,Suh, Il-Hwan
, p. 579 - 587 (2007/10/03)
5-Substituted 2-acylamino-1,3,4-thiadiazoles (2 and 3b) are quantitatively and regiospecifically alkylated with alkyl bromide at the 3-position nitrogen (endo-products) rather than at the 2-position amide-nitrogen (exo-products) under basic conditions. Th