845866-92-4 Usage
Uses
Used in Pharmaceutical Industry:
6-Amino-3-bromo-2-fluoro-benzonitrile is used as an intermediate in the synthesis of pharmaceuticals for its potential biological activity. It plays a crucial role in the development of new drugs and contributes to the advancement of medicinal chemistry.
Used in Agrochemical Industry:
6-Amino-3-bromo-2-fluoro-benzonitrile is used as a key component in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique properties make it suitable for the development of effective and environmentally friendly agricultural products.
Used in Organic Synthesis:
6-Amino-3-bromo-2-fluoro-benzonitrile is used as a versatile building block in the creation of various organic compounds. Its unique structure allows for the formation of a wide range of chemical entities, making it an essential component in the field of organic synthesis.
Used in Research and Development:
6-Amino-3-bromo-2-fluoro-benzonitrile is utilized in research and development for its potential applications in various industries. Its unique properties and reactivity make it an attractive candidate for the exploration of new chemical reactions and the development of innovative products.
Check Digit Verification of cas no
The CAS Registry Mumber 845866-92-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,5,8,6 and 6 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 845866-92:
(8*8)+(7*4)+(6*5)+(5*8)+(4*6)+(3*6)+(2*9)+(1*2)=224
224 % 10 = 4
So 845866-92-4 is a valid CAS Registry Number.
InChI:InChI=1S/C7H4BrFN2/c8-5-1-2-6(11)4(3-10)7(5)9/h1-2H,11H2
845866-92-4Relevant academic research and scientific papers
Synthesis method of 4-bromo-2-cyano-3-fluorobenzoic acid methyl ester
-
Paragraph 0013-0021, (2021/01/29)
The invention belongs to the technical field of medical intermediates, and particularly relates to a synthetic method of 4-bromo-2-cyano-3-fluorobenzoic acid methyl ester. A compound A is used as an initial raw material, and reacts with N-bromo succinimide to form a compound B, and then through subsequent reactions such as the reaction of the compound B, the 4-bromo-2-cyano-3-fluorobenzoic acid methyl ester is formed. The synthesis method of 4-bromo-2-cyano-3-fluorobenzoic acid methyl ester is put forward for the first time.
