84639-84-9 Usage
Uses
Used in Pharmaceutical Industry:
7-HYDROXY-1H-INDOLE-2-CARBOXYLIC ACID is used as a pharmaceutical precursor for the development of new drugs and therapeutic agents, leveraging its anti-inflammatory and anti-oxidant properties. Its chemical structure allows for potential modifications and enhancements to create more effective and targeted treatments for various conditions.
Used in Research and Development:
In the field of scientific research, 7-HYDROXY-1H-INDOLE-2-CARBOXYLIC ACID serves as a valuable compound for studying the effects of indole derivatives on biological systems. Its reactivity and structural features make it an ideal subject for exploring new chemical reactions and potential applications in medicine and other industries.
Used in Drug Discovery:
7-HYDROXY-1H-INDOLE-2-CARBOXYLIC ACID is utilized in drug discovery processes to identify and optimize potential drug candidates. Its unique properties and reactivity can contribute to the creation of novel therapeutic agents with improved efficacy and reduced side effects.
Used in Chemical Synthesis:
As a carboxylic acid derivative, 7-HYDROXY-1H-INDOLE-2-CARBOXYLIC ACID is employed in chemical synthesis for the production of various compounds and materials. Its versatility in forming different chemical bonds and its reactivity make it a valuable component in the synthesis of complex organic molecules.
Overall, 7-HYDROXY-1H-INDOLE-2-CARBOXYLIC ACID's diverse applications across various industries highlight its potential as a versatile and valuable chemical compound with significant implications for pharmaceutical development, scientific research, and chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 84639-84-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,6,3 and 9 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 84639-84:
(7*8)+(6*4)+(5*6)+(4*3)+(3*9)+(2*8)+(1*4)=169
169 % 10 = 9
So 84639-84-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NO3/c11-7-3-1-2-5-4-6(9(12)13)10-8(5)7/h1-4,10-11H,(H,12,13)
