84944-77-4 Usage
General Description
2,3-Dihydro-5,7-dinitrobenzofuran is a chemical compound that belongs to the class of nitrobenzofurans. It is a yellow solid substance that is primarily used as a synthetic intermediate in the production of various pharmaceuticals and organic compounds. Due to its structural characteristics, it possesses strong electron-withdrawing properties, making it useful in chemical reactions involving aromatic compounds. It is also known for its potential as a high-energy material, which has led to research into its use as an energetic ingredient in propellants and explosives. Additionally, it has been studied for its potential pharmacological properties, including its anti-cancer and anti-inflammatory effects. However, its production and use may be subject to regulatory restrictions due to its potentially hazardous properties.
Check Digit Verification of cas no
The CAS Registry Mumber 84944-77-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,9,4 and 4 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 84944-77:
(7*8)+(6*4)+(5*9)+(4*4)+(3*4)+(2*7)+(1*7)=174
174 % 10 = 4
So 84944-77-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N2O5/c11-9(12)6-3-5-1-2-15-8(5)7(4-6)10(13)14/h3-4H,1-2H2
